C17H20N4O3S — CID 58406169
(16S)-16-methyl-5-(2-methylsulfonylethyl)-14-oxa-8,11,17-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),3,5,8,11-hexaen-9-amine (PubChem CID 58406169) has the molecular formula C17H20N4O3S and a molecular weight of 360.44 g/mol. Its IUPAC name is (16S)-16-methyl-5-(2-methylsulfonylethyl)-14-oxa-8,11,17-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),3,5,8,11-hexaen-9-amine.
| Compound Name | (16S)-16-methyl-5-(2-methylsulfonylethyl)-14-oxa-8,11,17-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),3,5,8,11-hexaen-9-amine |
|---|---|
| PubChem CID | 58406169 |
| Molecular Formula | C17H20N4O3S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | (16S)-16-methyl-5-(2-methylsulfonylethyl)-14-oxa-8,11,17-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),3,5,8,11-hexaen-9-amine |
| SMILES | C[C@H]1COCc2nc3c(N)nc4cc(CCS(C)(=O)=O)ccc4c3n21 |
| InChI | InChI=1S/C17H20N4O3S/c1-10-8-24-9-14-20-15-16(21(10)14)12-4-3-11(5-6-25(2,22)23)7-13(12)19-17(15)18/h3-4,7,10H,5-6,8-9H2,1-2H3,(H2,18,19)/t10-/m0/s1 |
| InChIKey | JJURZLCOIUBOGN-JTQLQIEISA-N |
| XLogP | 1.85 |
| TPSA | 100.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |