C26H26N6O4 — CID 58406348
11-(1,3-dimethylpyrazol-4-yl)-3-(4-methoxyphenyl)-4-(3-methyl-1,2-oxazole-4-carbonyl)-1,4,7-triazatricyclo[7.3.0.03,7]dodeca-9,11-dien-8-one (PubChem CID 58406348) has the molecular formula C26H26N6O4 and a molecular weight of 486.53 g/mol. Its IUPAC name is 11-(1,3-dimethylpyrazol-4-yl)-3-(4-methoxyphenyl)-4-(3-methyl-1,2-oxazole-4-carbonyl)-1,4,7-triazatricyclo[7.3.0.03,7]dodeca-9,11-dien-8-one.
| Compound Name | 11-(1,3-dimethylpyrazol-4-yl)-3-(4-methoxyphenyl)-4-(3-methyl-1,2-oxazole-4-carbonyl)-1,4,7-triazatricyclo[7.3.0.03,7]dodeca-9,11-dien-8-one |
|---|---|
| PubChem CID | 58406348 |
| Molecular Formula | C26H26N6O4 |
| Molecular Weight | 486.53 g/mol |
| Exact Mass | 486.20 |
| IUPAC Name | 11-(1,3-dimethylpyrazol-4-yl)-3-(4-methoxyphenyl)-4-(3-methyl-1,2-oxazole-4-carbonyl)-1,4,7-triazatricyclo[7.3.0.03,7]dodeca-9,11-dien-8-one |
| SMILES | COc1ccc(C23Cn4cc(-c5cn(C)nc5C)cc4C(=O)N2CCN3C(=O)c2conc2C)cc1 |
| InChI | InChI=1S/C26H26N6O4/c1-16-21(13-29(3)27-16)18-11-23-25(34)32-10-9-31(24(33)22-14-36-28-17(22)2)26(32,15-30(23)12-18)19-5-7-20(35-4)8-6-19/h5-8,11-14H,9-10,15H2,1-4H3 |
| InChIKey | RKJSJIWJBLCGDI-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 98.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.53 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |