C19H17F2N3O — CID 58406509
N-(diaminomethylidene)-8-(4,5-difluoro-2-methylphenyl)-5,6-dihydronaphthalene-2-carboxamide (PubChem CID 58406509) has the molecular formula C19H17F2N3O and a molecular weight of 341.36 g/mol. Its IUPAC name is N-(diaminomethylidene)-8-(4,5-difluoro-2-methylphenyl)-5,6-dihydronaphthalene-2-carboxamide.
| Compound Name | N-(diaminomethylidene)-8-(4,5-difluoro-2-methylphenyl)-5,6-dihydronaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 58406509 |
| Molecular Formula | C19H17F2N3O |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | N-(diaminomethylidene)-8-(4,5-difluoro-2-methylphenyl)-5,6-dihydronaphthalene-2-carboxamide |
| SMILES | Cc1cc(F)c(F)cc1C1=CCCc2ccc(C(=O)N=C(N)N)cc21 |
| InChI | InChI=1S/C19H17F2N3O/c1-10-7-16(20)17(21)9-14(10)13-4-2-3-11-5-6-12(8-15(11)13)18(25)24-19(22)23/h4-9H,2-3H2,1H3,(H4,22,23,24,25) |
| InChIKey | WVZWCGLJSLQEHK-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|