C20H18F3N3O — CID 58406683
N-(diaminomethylidene)-5,5-dimethyl-8-(2,4,6-trifluorophenyl)-6H-naphthalene-2-carboxamide (PubChem CID 58406683) has the molecular formula C20H18F3N3O and a molecular weight of 373.38 g/mol. Its IUPAC name is N-(diaminomethylidene)-5,5-dimethyl-8-(2,4,6-trifluorophenyl)-6H-naphthalene-2-carboxamide.
| Compound Name | N-(diaminomethylidene)-5,5-dimethyl-8-(2,4,6-trifluorophenyl)-6H-naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 58406683 |
| Molecular Formula | C20H18F3N3O |
| Molecular Weight | 373.38 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | N-(diaminomethylidene)-5,5-dimethyl-8-(2,4,6-trifluorophenyl)-6H-naphthalene-2-carboxamide |
| SMILES | CC1(C)CC=C(c2c(F)cc(F)cc2F)c2cc(C(=O)N=C(N)N)ccc21 |
| InChI | InChI=1S/C20H18F3N3O/c1-20(2)6-5-12(17-15(22)8-11(21)9-16(17)23)13-7-10(3-4-14(13)20)18(27)26-19(24)25/h3-5,7-9H,6H2,1-2H3,(H4,24,25,26,27) |
| InChIKey | FCLYUBXTHMIKIE-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.38 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|