C19H16F3N3O — CID 58406914
N-(diaminomethylidene)-5-(2,4,6-trifluorophenyl)-8,9-dihydro-7H-benzo[7]annulene-3-carboxamide (PubChem CID 58406914) has the molecular formula C19H16F3N3O and a molecular weight of 359.35 g/mol. Its IUPAC name is N-(diaminomethylidene)-5-(2,4,6-trifluorophenyl)-8,9-dihydro-7H-benzo[7]annulene-3-carboxamide.
| Compound Name | N-(diaminomethylidene)-5-(2,4,6-trifluorophenyl)-8,9-dihydro-7H-benzo[7]annulene-3-carboxamide |
|---|---|
| PubChem CID | 58406914 |
| Molecular Formula | C19H16F3N3O |
| Molecular Weight | 359.35 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | N-(diaminomethylidene)-5-(2,4,6-trifluorophenyl)-8,9-dihydro-7H-benzo[7]annulene-3-carboxamide |
| SMILES | NC(N)=NC(=O)c1ccc2c(c1)C(c1c(F)cc(F)cc1F)=CCCC2 |
| InChI | InChI=1S/C19H16F3N3O/c20-12-8-15(21)17(16(22)9-12)13-4-2-1-3-10-5-6-11(7-14(10)13)18(26)25-19(23)24/h4-9H,1-3H2,(H4,23,24,25,26) |
| InChIKey | ZKAPLNUHDJRJNP-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.35 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|