C17H18N4O2S — CID 58407474
N-(diaminomethylidene)-4-(2,4-dimethyl-1,3-thiazol-5-yl)-2-methyl-2H-chromene-6-carboxamide (PubChem CID 58407474) has the molecular formula C17H18N4O2S and a molecular weight of 342.42 g/mol. Its IUPAC name is N-(diaminomethylidene)-4-(2,4-dimethyl-1,3-thiazol-5-yl)-2-methyl-2H-chromene-6-carboxamide.
| Compound Name | N-(diaminomethylidene)-4-(2,4-dimethyl-1,3-thiazol-5-yl)-2-methyl-2H-chromene-6-carboxamide |
|---|---|
| PubChem CID | 58407474 |
| Molecular Formula | C17H18N4O2S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | N-(diaminomethylidene)-4-(2,4-dimethyl-1,3-thiazol-5-yl)-2-methyl-2H-chromene-6-carboxamide |
| SMILES | Cc1nc(C)c(C2=CC(C)Oc3ccc(C(=O)N=C(N)N)cc32)s1 |
| InChI | InChI=1S/C17H18N4O2S/c1-8-6-13(15-9(2)20-10(3)24-15)12-7-11(4-5-14(12)23-8)16(22)21-17(18)19/h4-8H,1-3H3,(H4,18,19,21,22) |
| InChIKey | DQTKLOAYAUBBHK-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 103.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|