C30H37ClFN7O5Si — CID 58407955
5-chloro-4-(3-fluoro-5-nitrophenoxy)-N-[2-methoxy-4-(4-methylpiperazin-1-yl)phenyl]-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-2-amine (PubChem CID 58407955) has the molecular formula C30H37ClFN7O5Si and a molecular weight of 658.21 g/mol. Its IUPAC name is 5-chloro-4-(3-fluoro-5-nitrophenoxy)-N-[2-methoxy-4-(4-methylpiperazin-1-yl)phenyl]-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-2-amine.
| Compound Name | 5-chloro-4-(3-fluoro-5-nitrophenoxy)-N-[2-methoxy-4-(4-methylpiperazin-1-yl)phenyl]-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 58407955 |
| Molecular Formula | C30H37ClFN7O5Si |
| Molecular Weight | 658.21 g/mol |
| Exact Mass | 657.23 |
| IUPAC Name | 5-chloro-4-(3-fluoro-5-nitrophenoxy)-N-[2-methoxy-4-(4-methylpiperazin-1-yl)phenyl]-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-2-amine |
| SMILES | COc1cc(N2CCN(C)CC2)ccc1Nc1nc(Oc2cc(F)cc([N+](=O)[O-])c2)c2c(Cl)cn(COCC[Si](C)(C)C)c2n1 |
| InChI | InChI=1S/C30H37ClFN7O5Si/c1-36-8-10-37(11-9-36)21-6-7-25(26(17-21)42-2)33-30-34-28-27(24(31)18-38(28)19-43-12-13-45(3,4)5)29(35-30)44-23-15-20(32)14-22(16-23)39(40)41/h6-7,14-18H,8-13,19H2,1-5H3,(H,33,34,35) |
| InChIKey | POMCVBIGBLNRIC-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 120.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.21 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|