C30H39ClFN7O3Si — CID 58407987
4-(3-amino-5-fluorophenoxy)-5-chloro-N-[2-methoxy-4-(4-methylpiperazin-1-yl)phenyl]-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-2-amine (PubChem CID 58407987) has the molecular formula C30H39ClFN7O3Si and a molecular weight of 628.23 g/mol. Its IUPAC name is 4-(3-amino-5-fluorophenoxy)-5-chloro-N-[2-methoxy-4-(4-methylpiperazin-1-yl)phenyl]-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-2-amine.
| Compound Name | 4-(3-amino-5-fluorophenoxy)-5-chloro-N-[2-methoxy-4-(4-methylpiperazin-1-yl)phenyl]-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 58407987 |
| Molecular Formula | C30H39ClFN7O3Si |
| Molecular Weight | 628.23 g/mol |
| Exact Mass | 627.26 |
| IUPAC Name | 4-(3-amino-5-fluorophenoxy)-5-chloro-N-[2-methoxy-4-(4-methylpiperazin-1-yl)phenyl]-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-2-amine |
| SMILES | COc1cc(N2CCN(C)CC2)ccc1Nc1nc(Oc2cc(N)cc(F)c2)c2c(Cl)cn(COCC[Si](C)(C)C)c2n1 |
| InChI | InChI=1S/C30H39ClFN7O3Si/c1-37-8-10-38(11-9-37)22-6-7-25(26(17-22)40-2)34-30-35-28-27(24(31)18-39(28)19-41-12-13-43(3,4)5)29(36-30)42-23-15-20(32)14-21(33)16-23/h6-7,14-18H,8-13,19,33H2,1-5H3,(H,34,35,36) |
| InChIKey | AGQBBNGDUZHJOE-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 102.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.23 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|