C25H25N7O2 — CID 58408019
N-[3-[2-[(2,7-dimethyl-3,4-dihydro-1H-isoquinolin-6-yl)amino]pyrazolo[1,5-a][1,3,5]triazin-4-yl]oxyphenyl]prop-2-enamide (PubChem CID 58408019) has the molecular formula C25H25N7O2 and a molecular weight of 455.52 g/mol. Its IUPAC name is N-[3-[2-[(2,7-dimethyl-3,4-dihydro-1H-isoquinolin-6-yl)amino]pyrazolo[1,5-a][1,3,5]triazin-4-yl]oxyphenyl]prop-2-enamide.
| Compound Name | N-[3-[2-[(2,7-dimethyl-3,4-dihydro-1H-isoquinolin-6-yl)amino]pyrazolo[1,5-a][1,3,5]triazin-4-yl]oxyphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 58408019 |
| Molecular Formula | C25H25N7O2 |
| Molecular Weight | 455.52 g/mol |
| Exact Mass | 455.21 |
| IUPAC Name | N-[3-[2-[(2,7-dimethyl-3,4-dihydro-1H-isoquinolin-6-yl)amino]pyrazolo[1,5-a][1,3,5]triazin-4-yl]oxyphenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(Oc2nc(Nc3cc4c(cc3C)CN(C)CC4)nc3ccnn23)c1 |
| InChI | InChI=1S/C25H25N7O2/c1-4-23(33)27-19-6-5-7-20(14-19)34-25-30-24(29-22-8-10-26-32(22)25)28-21-13-17-9-11-31(3)15-18(17)12-16(21)2/h4-8,10,12-14H,1,9,11,15H2,2-3H3,(H,27,33)(H,28,29) |
| InChIKey | FRTNSYIKZQVRLP-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 96.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.52 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|