C32H35FN4O3 — CID 58408186
2-[(3aS,6aR)-1-[[3-ethoxy-4-(4-fluorophenyl)-5-methoxyphenyl]methyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-4-yl]-1-(1-methylbenzotriazol-5-yl)ethanone (PubChem CID 58408186) has the molecular formula C32H35FN4O3 and a molecular weight of 542.66 g/mol. Its IUPAC name is 2-[(3aS,6aR)-1-[[3-ethoxy-4-(4-fluorophenyl)-5-methoxyphenyl]methyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-4-yl]-1-(1-methylbenzotriazol-5-yl)ethanone.
| Compound Name | 2-[(3aS,6aR)-1-[[3-ethoxy-4-(4-fluorophenyl)-5-methoxyphenyl]methyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-4-yl]-1-(1-methylbenzotriazol-5-yl)ethanone |
|---|---|
| PubChem CID | 58408186 |
| Molecular Formula | C32H35FN4O3 |
| Molecular Weight | 542.66 g/mol |
| Exact Mass | 542.27 |
| IUPAC Name | 2-[(3aS,6aR)-1-[[3-ethoxy-4-(4-fluorophenyl)-5-methoxyphenyl]methyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-4-yl]-1-(1-methylbenzotriazol-5-yl)ethanone |
| SMILES | CCOc1cc(CN2CC[C@H]3C(CC(=O)c4ccc5c(c4)nnn5C)CC[C@H]32)cc(OC)c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C32H35FN4O3/c1-4-40-31-16-20(15-30(39-3)32(31)21-5-9-24(33)10-6-21)19-37-14-13-25-22(7-11-27(25)37)18-29(38)23-8-12-28-26(17-23)34-35-36(28)2/h5-6,8-10,12,15-17,22,25,27H,4,7,11,13-14,18-19H2,1-3H3/t22?,25-,27+/m0/s1 |
| InChIKey | MLNCGMSWEVSIBO-SNHWACLSSA-N |
| XLogP | 6.06 |
| TPSA | 69.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.66 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |