C24H21N3O6S — CID 58408304
3-[4-[[5-(2,6-dimethoxy-3-pyridinyl)-2,3-dihydroindol-1-yl]sulfonyl]phenyl]-4H-1,2-oxazol-5-one (PubChem CID 58408304) has the molecular formula C24H21N3O6S and a molecular weight of 479.51 g/mol. Its IUPAC name is 3-[4-[[5-(2,6-dimethoxy-3-pyridinyl)-2,3-dihydroindol-1-yl]sulfonyl]phenyl]-4H-1,2-oxazol-5-one.
| Compound Name | 3-[4-[[5-(2,6-dimethoxy-3-pyridinyl)-2,3-dihydroindol-1-yl]sulfonyl]phenyl]-4H-1,2-oxazol-5-one |
|---|---|
| PubChem CID | 58408304 |
| Molecular Formula | C24H21N3O6S |
| Molecular Weight | 479.51 g/mol |
| Exact Mass | 479.12 |
| IUPAC Name | 3-[4-[[5-(2,6-dimethoxy-3-pyridinyl)-2,3-dihydroindol-1-yl]sulfonyl]phenyl]-4H-1,2-oxazol-5-one |
| SMILES | COc1ccc(-c2ccc3c(c2)CCN3S(=O)(=O)c2ccc(C3=NOC(=O)C3)cc2)c(OC)n1 |
| InChI | InChI=1S/C24H21N3O6S/c1-31-22-10-8-19(24(25-22)32-2)16-5-9-21-17(13-16)11-12-27(21)34(29,30)18-6-3-15(4-7-18)20-14-23(28)33-26-20/h3-10,13H,11-12,14H2,1-2H3 |
| InChIKey | OLWUAIQLDFVYMH-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 107.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.51 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|