C32H30ClN3O5 — CID 58408664
[(1S)-1-(chloromethyl)-5-hydroxy-9-methyl-1,2-dihydrobenzo[e]indol-3-yl]-[2-[4-[2-(2-hydroxyethoxy)ethoxy]phenyl]-3H-benzimidazol-5-yl]methanone (PubChem CID 58408664) has the molecular formula C32H30ClN3O5 and a molecular weight of 572.06 g/mol. Its IUPAC name is [(1S)-1-(chloromethyl)-5-hydroxy-9-methyl-1,2-dihydrobenzo[e]indol-3-yl]-[2-[4-[2-(2-hydroxyethoxy)ethoxy]phenyl]-3H-benzimidazol-5-yl]methanone.
| Compound Name | [(1S)-1-(chloromethyl)-5-hydroxy-9-methyl-1,2-dihydrobenzo[e]indol-3-yl]-[2-[4-[2-(2-hydroxyethoxy)ethoxy]phenyl]-3H-benzimidazol-5-yl]methanone |
|---|---|
| PubChem CID | 58408664 |
| Molecular Formula | C32H30ClN3O5 |
| Molecular Weight | 572.06 g/mol |
| Exact Mass | 571.19 |
| IUPAC Name | [(1S)-1-(chloromethyl)-5-hydroxy-9-methyl-1,2-dihydrobenzo[e]indol-3-yl]-[2-[4-[2-(2-hydroxyethoxy)ethoxy]phenyl]-3H-benzimidazol-5-yl]methanone |
| SMILES | Cc1cccc2c(O)cc3c(c12)[C@H](CCl)CN3C(=O)c1ccc2nc(-c3ccc(OCCOCCO)cc3)[nH]c2c1 |
| InChI | InChI=1S/C32H30ClN3O5/c1-19-3-2-4-24-28(38)16-27-30(29(19)24)22(17-33)18-36(27)32(39)21-7-10-25-26(15-21)35-31(34-25)20-5-8-23(9-6-20)41-14-13-40-12-11-37/h2-10,15-16,22,37-38H,11-14,17-18H2,1H3,(H,34,35)/t22-/m1/s1 |
| InChIKey | LRUDFPIBFCPLPA-JOCHJYFZSA-N |
| XLogP | 5.77 |
| TPSA | 107.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.06 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|