C29H24ClN5O3 — CID 58408700
N-(4-aminophenyl)-6-[(1S)-1-(chloromethyl)-5-hydroxy-9-methyl-1,2-dihydrobenzo[e]indole-3-carbonyl]-1H-benzimidazole-2-carboxamide (PubChem CID 58408700) has the molecular formula C29H24ClN5O3 and a molecular weight of 526.00 g/mol. Its IUPAC name is N-(4-aminophenyl)-6-[(1S)-1-(chloromethyl)-5-hydroxy-9-methyl-1,2-dihydrobenzo[e]indole-3-carbonyl]-1H-benzimidazole-2-carboxamide.
| Compound Name | N-(4-aminophenyl)-6-[(1S)-1-(chloromethyl)-5-hydroxy-9-methyl-1,2-dihydrobenzo[e]indole-3-carbonyl]-1H-benzimidazole-2-carboxamide |
|---|---|
| PubChem CID | 58408700 |
| Molecular Formula | C29H24ClN5O3 |
| Molecular Weight | 526.00 g/mol |
| Exact Mass | 525.16 |
| IUPAC Name | N-(4-aminophenyl)-6-[(1S)-1-(chloromethyl)-5-hydroxy-9-methyl-1,2-dihydrobenzo[e]indole-3-carbonyl]-1H-benzimidazole-2-carboxamide |
| SMILES | Cc1cccc2c(O)cc3c(c12)[C@H](CCl)CN3C(=O)c1ccc2nc(C(=O)Nc3ccc(N)cc3)[nH]c2c1 |
| InChI | InChI=1S/C29H24ClN5O3/c1-15-3-2-4-20-24(36)12-23-26(25(15)20)17(13-30)14-35(23)29(38)16-5-10-21-22(11-16)34-27(33-21)28(37)32-19-8-6-18(31)7-9-19/h2-12,17,36H,13-14,31H2,1H3,(H,32,37)(H,33,34)/t17-/m1/s1 |
| InChIKey | NYXSVHUZRNGOAU-QGZVFWFLSA-N |
| XLogP | 5.55 |
| TPSA | 124.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.00 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|