C25H29BrN2O5S — CID 58409104
tert-butyl 2-[(3-bromo-5-isocyanophenyl)methyl-[(2,2-dimethyl-3,4-dihydrochromen-6-yl)sulfonyl]amino]acetate (PubChem CID 58409104) has the molecular formula C25H29BrN2O5S and a molecular weight of 549.49 g/mol. Its IUPAC name is tert-butyl 2-[(3-bromo-5-isocyanophenyl)methyl-[(2,2-dimethyl-3,4-dihydrochromen-6-yl)sulfonyl]amino]acetate.
| Compound Name | tert-butyl 2-[(3-bromo-5-isocyanophenyl)methyl-[(2,2-dimethyl-3,4-dihydrochromen-6-yl)sulfonyl]amino]acetate |
|---|---|
| PubChem CID | 58409104 |
| Molecular Formula | C25H29BrN2O5S |
| Molecular Weight | 549.49 g/mol |
| Exact Mass | 548.10 |
| IUPAC Name | tert-butyl 2-[(3-bromo-5-isocyanophenyl)methyl-[(2,2-dimethyl-3,4-dihydrochromen-6-yl)sulfonyl]amino]acetate |
| SMILES | [C-]#[N+]c1cc(Br)cc(CN(CC(=O)OC(C)(C)C)S(=O)(=O)c2ccc3c(c2)CCC(C)(C)O3)c1 |
| InChI | InChI=1S/C25H29BrN2O5S/c1-24(2,3)33-23(29)16-28(15-17-11-19(26)14-20(12-17)27-6)34(30,31)21-7-8-22-18(13-21)9-10-25(4,5)32-22/h7-8,11-14H,9-10,15-16H2,1-5H3 |
| InChIKey | OLWHXNHKQBZDKA-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 77.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.49 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|