About 3,5-difluoro-1-N-[1-(4-methoxy-1-methylcyclohexyl)piperidin-4-yl]benzene-1,2-diamine
3,5-difluoro-1-N-[1-(4-methoxy-1-methylcyclohexyl)piperidin-4-yl]benzene-1,2-diamine (PubChem CID 58409123) has the molecular formula C19H29F2N3O
and a molecular weight of 353.46 g/mol. Its IUPAC name is 3,5-difluoro-1-N-[1-(4-methoxy-1-methylcyclohexyl)piperidin-4-yl]benzene-1,2-diamine.
Molecular Properties
| Compound Name | 3,5-difluoro-1-N-[1-(4-methoxy-1-methylcyclohexyl)piperidin-4-yl]benzene-1,2-diamine |
| PubChem CID | 58409123 |
| Molecular Formula | C19H29F2N3O |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.23 |
| IUPAC Name | 3,5-difluoro-1-N-[1-(4-methoxy-1-methylcyclohexyl)piperidin-4-yl]benzene-1,2-diamine |
| SMILES | COC1CCC(C)(N2CCC(Nc3cc(F)cc(F)c3N)CC2)CC1 |
| InChI | InChI=1S/C19H29F2N3O/c1-19(7-3-15(25-2)4-8-19)24-9-5-14(6-10-24)23-17-12-13(20)11-16(21)18(17)22/h11-12,14-15,23H,3-10,22H2,1-2H3 |
| InChIKey | HTUOXSJPAYFRKL-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3,5-difluoro-1-N-[1-(4-methoxy-1-methylcyclohexyl)piperidin-4-yl]benzene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-difluoro-1-N-[1-(4-methoxy-1-methylcyclohexyl)piperidin-4-yl]benzene-1,2-diamine?
The IUPAC name of 3,5-difluoro-1-N-[1-(4-methoxy-1-methylcyclohexyl)piperidin-4-yl]benzene-1,2-diamine (CID 58409123) is 3,5-difluoro-1-N-[1-(4-methoxy-1-methylcyclohexyl)piperidin-4-yl]benzene-1,2-diamine.
What is the SMILES notation for 3,5-difluoro-1-N-[1-(4-methoxy-1-methylcyclohexyl)piperidin-4-yl]benzene-1,2-diamine?
The canonical SMILES for 3,5-difluoro-1-N-[1-(4-methoxy-1-methylcyclohexyl)piperidin-4-yl]benzene-1,2-diamine is COC1CCC(C)(N2CCC(Nc3cc(F)cc(F)c3N)CC2)CC1.
What is the InChIKey of 3,5-difluoro-1-N-[1-(4-methoxy-1-methylcyclohexyl)piperidin-4-yl]benzene-1,2-diamine?
The InChIKey is HTUOXSJPAYFRKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H29F2N3O/c1-19(7-3-15(25-2)4-8-19)24-9-5-14(6-10-24)23-17-12-13(20)11-16(21)18(17)22/h11-12,14-15,23H,3-10,22H2,1-2H3.
What are the key properties of 3,5-difluoro-1-N-[1-(4-methoxy-1-methylcyclohexyl)piperidin-4-yl]benzene-1,2-diamine?
3,5-difluoro-1-N-[1-(4-methoxy-1-methylcyclohexyl)piperidin-4-yl]benzene-1,2-diamine has a molecular weight of 353.46 g/mol, XLogP of 3.77, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-difluoro-1-N-[1-(4-methoxy-1-methylcyclohexyl)piperidin-4-yl]benzene-1,2-diamine is sourced from PubChem (CID 58409123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).