C24H30F2N2O2 — CID 58409218
3-methylbutyl 2-[3-amino-5-[4-(difluoromethyl)anilino]-5,6,7,8-tetrahydronaphthalen-2-yl]acetate (PubChem CID 58409218) has the molecular formula C24H30F2N2O2 and a molecular weight of 416.51 g/mol. Its IUPAC name is 3-methylbutyl 2-[3-amino-5-[4-(difluoromethyl)anilino]-5,6,7,8-tetrahydronaphthalen-2-yl]acetate.
| Compound Name | 3-methylbutyl 2-[3-amino-5-[4-(difluoromethyl)anilino]-5,6,7,8-tetrahydronaphthalen-2-yl]acetate |
|---|---|
| PubChem CID | 58409218 |
| Molecular Formula | C24H30F2N2O2 |
| Molecular Weight | 416.51 g/mol |
| Exact Mass | 416.23 |
| IUPAC Name | 3-methylbutyl 2-[3-amino-5-[4-(difluoromethyl)anilino]-5,6,7,8-tetrahydronaphthalen-2-yl]acetate |
| SMILES | CC(C)CCOC(=O)Cc1cc2c(cc1N)C(Nc1ccc(C(F)F)cc1)CCC2 |
| InChI | InChI=1S/C24H30F2N2O2/c1-15(2)10-11-30-23(29)13-18-12-17-4-3-5-22(20(17)14-21(18)27)28-19-8-6-16(7-9-19)24(25)26/h6-9,12,14-15,22,24,28H,3-5,10-11,13,27H2,1-2H3 |
| InChIKey | RPUUNLYXHIBQLX-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.51 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|