C44H43BN2O — CID 58409334
4-[3-bis(2,4,6-trimethyl-3-pyridin-3-ylphenyl)boranyl-2,4,6-trimethylphenyl]benzaldehyde (PubChem CID 58409334) has the molecular formula C44H43BN2O and a molecular weight of 626.65 g/mol. Its IUPAC name is 4-[3-bis(2,4,6-trimethyl-3-pyridin-3-ylphenyl)boranyl-2,4,6-trimethylphenyl]benzaldehyde.
| Compound Name | 4-[3-bis(2,4,6-trimethyl-3-pyridin-3-ylphenyl)boranyl-2,4,6-trimethylphenyl]benzaldehyde |
|---|---|
| PubChem CID | 58409334 |
| Molecular Formula | C44H43BN2O |
| Molecular Weight | 626.65 g/mol |
| Exact Mass | 626.35 |
| IUPAC Name | 4-[3-bis(2,4,6-trimethyl-3-pyridin-3-ylphenyl)boranyl-2,4,6-trimethylphenyl]benzaldehyde |
| SMILES | Cc1cc(C)c(-c2ccc(C=O)cc2)c(C)c1B(c1c(C)cc(C)c(-c2cccnc2)c1C)c1c(C)cc(C)c(-c2cccnc2)c1C |
| InChI | InChI=1S/C44H43BN2O/c1-26-20-29(4)42(32(7)39(26)36-16-14-35(25-48)15-17-36)45(43-30(5)21-27(2)40(33(43)8)37-12-10-18-46-23-37)44-31(6)22-28(3)41(34(44)9)38-13-11-19-47-24-38/h10-25H,1-9H3 |
| InChIKey | HZHVYQLUPUBHLX-UHFFFAOYSA-N |
| XLogP | 8.58 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.65 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|