C25H28ClFN3O6P — CID 58409481
1-[4-(3-chloro-4-fluoroanilino)-7-(oxolan-3-yloxy)quinazolin-6-yl]-3-diethoxyphosphorylpropan-2-one (PubChem CID 58409481) has the molecular formula C25H28ClFN3O6P and a molecular weight of 551.94 g/mol. Its IUPAC name is 1-[4-(3-chloro-4-fluoroanilino)-7-(oxolan-3-yloxy)quinazolin-6-yl]-3-diethoxyphosphorylpropan-2-one.
| Compound Name | 1-[4-(3-chloro-4-fluoroanilino)-7-(oxolan-3-yloxy)quinazolin-6-yl]-3-diethoxyphosphorylpropan-2-one |
|---|---|
| PubChem CID | 58409481 |
| Molecular Formula | C25H28ClFN3O6P |
| Molecular Weight | 551.94 g/mol |
| Exact Mass | 551.14 |
| IUPAC Name | 1-[4-(3-chloro-4-fluoroanilino)-7-(oxolan-3-yloxy)quinazolin-6-yl]-3-diethoxyphosphorylpropan-2-one |
| SMILES | CCOP(=O)(CC(=O)Cc1cc2c(Nc3ccc(F)c(Cl)c3)ncnc2cc1OC1CCOC1)OCC |
| InChI | InChI=1S/C25H28ClFN3O6P/c1-3-34-37(32,35-4-2)14-18(31)9-16-10-20-23(12-24(16)36-19-7-8-33-13-19)28-15-29-25(20)30-17-5-6-22(27)21(26)11-17/h5-6,10-12,15,19H,3-4,7-9,13-14H2,1-2H3,(H,28,29,30) |
| InChIKey | WZLRMSNUCJNBAS-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 108.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.94 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|