C25H26ClFN4O3 — CID 58409485
(E)-1-[4-(3-chloro-4-fluoroanilino)-7-(oxolan-3-yloxy)quinazolin-6-yl]-5-(dimethylamino)pent-3-en-2-one (PubChem CID 58409485) has the molecular formula C25H26ClFN4O3 and a molecular weight of 484.96 g/mol. Its IUPAC name is (E)-1-[4-(3-chloro-4-fluoroanilino)-7-(oxolan-3-yloxy)quinazolin-6-yl]-5-(dimethylamino)pent-3-en-2-one.
| Compound Name | (E)-1-[4-(3-chloro-4-fluoroanilino)-7-(oxolan-3-yloxy)quinazolin-6-yl]-5-(dimethylamino)pent-3-en-2-one |
|---|---|
| PubChem CID | 58409485 |
| Molecular Formula | C25H26ClFN4O3 |
| Molecular Weight | 484.96 g/mol |
| Exact Mass | 484.17 |
| IUPAC Name | (E)-1-[4-(3-chloro-4-fluoroanilino)-7-(oxolan-3-yloxy)quinazolin-6-yl]-5-(dimethylamino)pent-3-en-2-one |
| SMILES | CN(C)C/C=C/C(=O)Cc1cc2c(Nc3ccc(F)c(Cl)c3)ncnc2cc1OC1CCOC1 |
| InChI | InChI=1S/C25H26ClFN4O3/c1-31(2)8-3-4-18(32)10-16-11-20-23(13-24(16)34-19-7-9-33-14-19)28-15-29-25(20)30-17-5-6-22(27)21(26)12-17/h3-6,11-13,15,19H,7-10,14H2,1-2H3,(H,28,29,30)/b4-3+ |
| InChIKey | YITIQKKTELXLAV-ONEGZZNKSA-N |
| XLogP | 4.56 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.96 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|