C18H23N5O3 — CID 58409572
1-(cyclohexylmethyl)-3-[1-[(5-methyl-1,2-oxazol-4-yl)methyl]pyrazol-4-yl]imidazolidine-2,4-dione (PubChem CID 58409572) has the molecular formula C18H23N5O3 and a molecular weight of 357.41 g/mol. Its IUPAC name is 1-(cyclohexylmethyl)-3-[1-[(5-methyl-1,2-oxazol-4-yl)methyl]pyrazol-4-yl]imidazolidine-2,4-dione.
| Compound Name | 1-(cyclohexylmethyl)-3-[1-[(5-methyl-1,2-oxazol-4-yl)methyl]pyrazol-4-yl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 58409572 |
| Molecular Formula | C18H23N5O3 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | 1-(cyclohexylmethyl)-3-[1-[(5-methyl-1,2-oxazol-4-yl)methyl]pyrazol-4-yl]imidazolidine-2,4-dione |
| SMILES | Cc1oncc1Cn1cc(N2C(=O)CN(CC3CCCCC3)C2=O)cn1 |
| InChI | InChI=1S/C18H23N5O3/c1-13-15(7-20-26-13)10-22-11-16(8-19-22)23-17(24)12-21(18(23)25)9-14-5-3-2-4-6-14/h7-8,11,14H,2-6,9-10,12H2,1H3 |
| InChIKey | ZXSAOWRQYITXTJ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 84.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|