C18H34O7Si — CID 58409695
dimethyl (Z)-2-[(1S,2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-1,2-dihydroxyhexyl]but-2-enedioate (PubChem CID 58409695) has the molecular formula C18H34O7Si and a molecular weight of 390.55 g/mol. Its IUPAC name is dimethyl (Z)-2-[(1S,2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-1,2-dihydroxyhexyl]but-2-enedioate.
| Compound Name | dimethyl (Z)-2-[(1S,2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-1,2-dihydroxyhexyl]but-2-enedioate |
|---|---|
| PubChem CID | 58409695 |
| Molecular Formula | C18H34O7Si |
| Molecular Weight | 390.55 g/mol |
| Exact Mass | 390.21 |
| IUPAC Name | dimethyl (Z)-2-[(1S,2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-1,2-dihydroxyhexyl]but-2-enedioate |
| SMILES | CCC[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)/C(=C/C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C18H34O7Si/c1-9-10-13(25-26(7,8)18(2,3)4)16(21)15(20)12(17(22)24-6)11-14(19)23-5/h11,13,15-16,20-21H,9-10H2,1-8H3/b12-11-/t13-,15-,16-/m0/s1 |
| InChIKey | ASNRJZLRXRAVNX-KUOSCBCBSA-N |
| XLogP | 2.17 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.55 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|