C15H22O11 — CID 58409701
dimethyl (2S,3R,4R,5R,9R)-3,4,9-trihydroxy-2-methoxy-6-oxo-2-propyl-1,7-dioxaspiro[4.4]nonane-8,9-dicarboxylate (PubChem CID 58409701) has the molecular formula C15H22O11 and a molecular weight of 378.33 g/mol. Its IUPAC name is dimethyl (2S,3R,4R,5R,9R)-3,4,9-trihydroxy-2-methoxy-6-oxo-2-propyl-1,7-dioxaspiro[4.4]nonane-8,9-dicarboxylate.
| Compound Name | dimethyl (2S,3R,4R,5R,9R)-3,4,9-trihydroxy-2-methoxy-6-oxo-2-propyl-1,7-dioxaspiro[4.4]nonane-8,9-dicarboxylate |
|---|---|
| PubChem CID | 58409701 |
| Molecular Formula | C15H22O11 |
| Molecular Weight | 378.33 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | dimethyl (2S,3R,4R,5R,9R)-3,4,9-trihydroxy-2-methoxy-6-oxo-2-propyl-1,7-dioxaspiro[4.4]nonane-8,9-dicarboxylate |
| SMILES | CCC[C@]1(OC)O[C@]2(C(=O)OC(C(=O)OC)[C@]2(O)C(=O)OC)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C15H22O11/c1-5-6-13(24-4)7(16)8(17)15(26-13)12(20)25-9(10(18)22-2)14(15,21)11(19)23-3/h7-9,16-17,21H,5-6H2,1-4H3/t7-,8-,9?,13+,14+,15+/m1/s1 |
| InChIKey | YZFSVJWAHUJODH-KBXSWICLSA-N |
| XLogP | -2.38 |
| TPSA | 158.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.33 |
| LogP ≤ 5 | -2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|