C21H40O9Si — CID 58409702
dimethyl (2R,3R)-2-[(4R,5R)-5-[(1S)-1-[tert-butyl(dimethyl)silyl]oxybutyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2,3-dihydroxybutanedioate (PubChem CID 58409702) has the molecular formula C21H40O9Si and a molecular weight of 464.63 g/mol. Its IUPAC name is dimethyl (2R,3R)-2-[(4R,5R)-5-[(1S)-1-[tert-butyl(dimethyl)silyl]oxybutyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2,3-dihydroxybutanedioate.
| Compound Name | dimethyl (2R,3R)-2-[(4R,5R)-5-[(1S)-1-[tert-butyl(dimethyl)silyl]oxybutyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2,3-dihydroxybutanedioate |
|---|---|
| PubChem CID | 58409702 |
| Molecular Formula | C21H40O9Si |
| Molecular Weight | 464.63 g/mol |
| Exact Mass | 464.24 |
| IUPAC Name | dimethyl (2R,3R)-2-[(4R,5R)-5-[(1S)-1-[tert-butyl(dimethyl)silyl]oxybutyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2,3-dihydroxybutanedioate |
| SMILES | CCC[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1OC(C)(C)O[C@H]1[C@@](O)(C(=O)OC)[C@@H](O)C(=O)OC |
| InChI | InChI=1S/C21H40O9Si/c1-11-12-13(30-31(9,10)19(2,3)4)14-16(29-20(5,6)28-14)21(25,18(24)27-8)15(22)17(23)26-7/h13-16,22,25H,11-12H2,1-10H3/t13-,14-,15-,16+,21+/m0/s1 |
| InChIKey | PIWUQRUVXQHXDS-LNXOKNDVSA-N |
| XLogP | 2.13 |
| TPSA | 120.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.63 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|