C13H22O7 — CID 58409708
methyl (6R,7R)-4,6,7-trihydroxy-4,5-dimethyl-1-propyl-2,8-dioxabicyclo[3.2.1]octane-3-carboxylate (PubChem CID 58409708) has the molecular formula C13H22O7 and a molecular weight of 290.31 g/mol. Its IUPAC name is methyl (6R,7R)-4,6,7-trihydroxy-4,5-dimethyl-1-propyl-2,8-dioxabicyclo[3.2.1]octane-3-carboxylate.
| Compound Name | methyl (6R,7R)-4,6,7-trihydroxy-4,5-dimethyl-1-propyl-2,8-dioxabicyclo[3.2.1]octane-3-carboxylate |
|---|---|
| PubChem CID | 58409708 |
| Molecular Formula | C13H22O7 |
| Molecular Weight | 290.31 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | methyl (6R,7R)-4,6,7-trihydroxy-4,5-dimethyl-1-propyl-2,8-dioxabicyclo[3.2.1]octane-3-carboxylate |
| SMILES | CCCC12OC(C(=O)OC)C(C)(O)C(C)(O1)[C@H](O)[C@H]2O |
| InChI | InChI=1S/C13H22O7/c1-5-6-13-8(15)7(14)12(3,20-13)11(2,17)9(19-13)10(16)18-4/h7-9,14-15,17H,5-6H2,1-4H3/t7-,8-,9?,11?,12?,13?/m1/s1 |
| InChIKey | LDFJKHNWVBSYTB-IXFQONNTSA-N |
| XLogP | -0.68 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.31 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |