C17H30O7 — CID 58409712
methyl (6R,7R)-1-heptyl-4,6,7-trihydroxy-4,5-dimethyl-2,8-dioxabicyclo[3.2.1]octane-3-carboxylate (PubChem CID 58409712) has the molecular formula C17H30O7 and a molecular weight of 346.42 g/mol. Its IUPAC name is methyl (6R,7R)-1-heptyl-4,6,7-trihydroxy-4,5-dimethyl-2,8-dioxabicyclo[3.2.1]octane-3-carboxylate.
| Compound Name | methyl (6R,7R)-1-heptyl-4,6,7-trihydroxy-4,5-dimethyl-2,8-dioxabicyclo[3.2.1]octane-3-carboxylate |
|---|---|
| PubChem CID | 58409712 |
| Molecular Formula | C17H30O7 |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | methyl (6R,7R)-1-heptyl-4,6,7-trihydroxy-4,5-dimethyl-2,8-dioxabicyclo[3.2.1]octane-3-carboxylate |
| SMILES | CCCCCCCC12OC(C(=O)OC)C(C)(O)C(C)(O1)[C@H](O)[C@H]2O |
| InChI | InChI=1S/C17H30O7/c1-5-6-7-8-9-10-17-12(19)11(18)16(3,24-17)15(2,21)13(23-17)14(20)22-4/h11-13,18-19,21H,5-10H2,1-4H3/t11-,12-,13?,15?,16?,17?/m1/s1 |
| InChIKey | LZTQDJRVJOCQQS-WQBFZRLMSA-N |
| XLogP | 0.88 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|