C48H74O2 — CID 58409847
(5E,6E)-5,6-di(ethylidene)-2-[(2E,6E,10E,14E,18E,22E)-3,7,11,15,19,23,27-heptamethyloctacosa-2,6,10,14,18,22,26-heptaenyl]-1,4-dimethoxy-3-methylcyclohexa-1,3-diene (PubChem CID 58409847) has the molecular formula C48H74O2 and a molecular weight of 683.12 g/mol. Its IUPAC name is (5E,6E)-5,6-di(ethylidene)-2-[(2E,6E,10E,14E,18E,22E)-3,7,11,15,19,23,27-heptamethyloctacosa-2,6,10,14,18,22,26-heptaenyl]-1,4-dimethoxy-3-methylcyclohexa-1,3-diene.
| Compound Name | (5E,6E)-5,6-di(ethylidene)-2-[(2E,6E,10E,14E,18E,22E)-3,7,11,15,19,23,27-heptamethyloctacosa-2,6,10,14,18,22,26-heptaenyl]-1,4-dimethoxy-3-methylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 58409847 |
| Molecular Formula | C48H74O2 |
| Molecular Weight | 683.12 g/mol |
| Exact Mass | 682.57 |
| IUPAC Name | (5E,6E)-5,6-di(ethylidene)-2-[(2E,6E,10E,14E,18E,22E)-3,7,11,15,19,23,27-heptamethyloctacosa-2,6,10,14,18,22,26-heptaenyl]-1,4-dimethoxy-3-methylcyclohexa-1,3-diene |
| SMILES | C/C=c1/c(OC)c(C)c(C/C=C(\C)CC/C=C(\C)CC/C=C(\C)CC/C=C(\C)CC/C=C(\C)CC/C=C(\C)CCC=C(C)C)c(OC)/c1=C/C |
| InChI | InChI=1S/C48H74O2/c1-14-44-45(15-2)48(50-13)46(43(11)47(44)49-12)35-34-42(10)33-21-32-41(9)31-20-30-40(8)29-19-28-39(7)27-18-26-38(6)25-17-24-37(5)23-16-22-36(3)4/h14-15,22,24,26,28,30,32,34H,16-21,23,25,27,29,31,33,35H2,1-13H3/b37-24+,38-26+,39-28+,40-30+,41-32+,42-34+,44-14+,45-15+ |
| InChIKey | DYJINZPVGFANSU-DFIFZSQVSA-N |
| XLogP | 13.48 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.12 |
| LogP ≤ 5 | 13.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|