C21H30O3 — CID 58409853
(2E,6E)-8-(2,5-dimethoxy-6-methyl-3,4-dimethylidenecyclohexa-1,5-dien-1-yl)-2,6-dimethylocta-2,6-dien-1-ol (PubChem CID 58409853) has the molecular formula C21H30O3 and a molecular weight of 330.47 g/mol. Its IUPAC name is (2E,6E)-8-(2,5-dimethoxy-6-methyl-3,4-dimethylidenecyclohexa-1,5-dien-1-yl)-2,6-dimethylocta-2,6-dien-1-ol.
| Compound Name | (2E,6E)-8-(2,5-dimethoxy-6-methyl-3,4-dimethylidenecyclohexa-1,5-dien-1-yl)-2,6-dimethylocta-2,6-dien-1-ol |
|---|---|
| PubChem CID | 58409853 |
| Molecular Formula | C21H30O3 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | (2E,6E)-8-(2,5-dimethoxy-6-methyl-3,4-dimethylidenecyclohexa-1,5-dien-1-yl)-2,6-dimethylocta-2,6-dien-1-ol |
| SMILES | C=c1c(OC)c(C)c(C/C=C(\C)CC/C=C(\C)CO)c(OC)c1=C |
| InChI | InChI=1S/C21H30O3/c1-14(9-8-10-15(2)13-22)11-12-19-18(5)20(23-6)16(3)17(4)21(19)24-7/h10-11,22H,3-4,8-9,12-13H2,1-2,5-7H3/b14-11+,15-10+ |
| InChIKey | BOPGMCPTSMSWRS-QYFSLLALSA-N |
| XLogP | 3.04 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|