C32H48O2S — CID 58409854
2-[(2E,6E,10E,14E)-2,6,10,14-tetramethyl-8-phenylsulfanylheptadeca-2,6,10,14-tetraenoxy]oxane (PubChem CID 58409854) has the molecular formula C32H48O2S and a molecular weight of 496.80 g/mol. Its IUPAC name is 2-[(2E,6E,10E,14E)-2,6,10,14-tetramethyl-8-phenylsulfanylheptadeca-2,6,10,14-tetraenoxy]oxane.
| Compound Name | 2-[(2E,6E,10E,14E)-2,6,10,14-tetramethyl-8-phenylsulfanylheptadeca-2,6,10,14-tetraenoxy]oxane |
|---|---|
| PubChem CID | 58409854 |
| Molecular Formula | C32H48O2S |
| Molecular Weight | 496.80 g/mol |
| Exact Mass | 496.34 |
| IUPAC Name | 2-[(2E,6E,10E,14E)-2,6,10,14-tetramethyl-8-phenylsulfanylheptadeca-2,6,10,14-tetraenoxy]oxane |
| SMILES | CC/C=C(\C)CC/C=C(\C)CC(/C=C(\C)CC/C=C(\C)COC1CCCCO1)Sc1ccccc1 |
| InChI | InChI=1S/C32H48O2S/c1-6-14-26(2)15-12-16-27(3)23-31(35-30-19-8-7-9-20-30)24-28(4)17-13-18-29(5)25-34-32-21-10-11-22-33-32/h7-9,14,16,18-20,24,31-32H,6,10-13,15,17,21-23,25H2,1-5H3/b26-14+,27-16+,28-24+,29-18+ |
| InChIKey | UAKBIRUAUZYFAK-CREBQQLFSA-N |
| XLogP | 9.84 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.80 |
| LogP ≤ 5 | 9.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|