C17H36O4 — CID 58409902
1,5-bis(tert-butylperoxy)-2,2,5-trimethylhexane (PubChem CID 58409902) has the molecular formula C17H36O4 and a molecular weight of 304.47 g/mol. Its IUPAC name is 1,5-bis(tert-butylperoxy)-2,2,5-trimethylhexane.
| Compound Name | 1,5-bis(tert-butylperoxy)-2,2,5-trimethylhexane |
|---|---|
| PubChem CID | 58409902 |
| Molecular Formula | C17H36O4 |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.26 |
| IUPAC Name | 1,5-bis(tert-butylperoxy)-2,2,5-trimethylhexane |
| SMILES | CC(C)(CCC(C)(C)OOC(C)(C)C)COOC(C)(C)C |
| InChI | InChI=1S/C17H36O4/c1-14(2,3)19-18-13-16(7,8)11-12-17(9,10)21-20-15(4,5)6/h11-13H2,1-10H3 |
| InChIKey | NKVRNACSTROBCV-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|