C42H37N3 — CID 58410204
7,10-ditert-butyl-3-(3-carbazol-9-ylphenyl)phenanthro[9,10-b]pyrazine (PubChem CID 58410204) has the molecular formula C42H37N3 and a molecular weight of 583.78 g/mol. Its IUPAC name is 7,10-ditert-butyl-3-(3-carbazol-9-ylphenyl)phenanthro[9,10-b]pyrazine.
| Compound Name | 7,10-ditert-butyl-3-(3-carbazol-9-ylphenyl)phenanthro[9,10-b]pyrazine |
|---|---|
| PubChem CID | 58410204 |
| Molecular Formula | C42H37N3 |
| Molecular Weight | 583.78 g/mol |
| Exact Mass | 583.30 |
| IUPAC Name | 7,10-ditert-butyl-3-(3-carbazol-9-ylphenyl)phenanthro[9,10-b]pyrazine |
| SMILES | CC(C)(C)c1ccc2c(c1)c1cc(C(C)(C)C)ccc1c1nc(-c3cccc(-n4c5ccccc5c5ccccc54)c3)cnc21 |
| InChI | InChI=1S/C42H37N3/c1-41(2,3)27-18-20-32-34(23-27)35-24-28(42(4,5)6)19-21-33(35)40-39(32)43-25-36(44-40)26-12-11-13-29(22-26)45-37-16-9-7-14-30(37)31-15-8-10-17-38(31)45/h7-25H,1-6H3 |
| InChIKey | YVRNRGRBDOQGGF-UHFFFAOYSA-N |
| XLogP | 11.30 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.78 |
| LogP ≤ 5 | 11.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|