C29H20NY- — CID 58410518
11-methyl-8-(4-phenylphenyl)benzo[a]carbazole;yttrium (PubChem CID 58410518) has the molecular formula C29H20NY- and a molecular weight of 471.39 g/mol. Its IUPAC name is 11-methyl-8-(4-phenylphenyl)benzo[a]carbazole;yttrium.
| Compound Name | 11-methyl-8-(4-phenylphenyl)benzo[a]carbazole;yttrium |
|---|---|
| PubChem CID | 58410518 |
| Molecular Formula | C29H20NY- |
| Molecular Weight | 471.39 g/mol |
| Exact Mass | 471.07 |
| IUPAC Name | 11-methyl-8-(4-phenylphenyl)benzo[a]carbazole;yttrium |
| SMILES | Cn1c2ccc(-c3ccc(-c4cc[c-]cc4)cc3)cc2c2ccc3ccccc3c21.[Y] |
| InChI | InChI=1S/C29H20N.Y/c1-30-28-18-16-24(22-13-11-21(12-14-22)20-7-3-2-4-8-20)19-27(28)26-17-15-23-9-5-6-10-25(23)29(26)30;/h3-19H,1H3;/q-1; |
| InChIKey | WINNGFAHAQCJLF-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.39 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|