About N-benzyl-6-methyl-3,4-dihydro-2H-naphthalen-1-imine
N-benzyl-6-methyl-3,4-dihydro-2H-naphthalen-1-imine (PubChem CID 58410610) has the molecular formula C18H19N
and a molecular weight of 249.36 g/mol. Its IUPAC name is N-benzyl-6-methyl-3,4-dihydro-2H-naphthalen-1-imine.
Molecular Properties
| Compound Name | N-benzyl-6-methyl-3,4-dihydro-2H-naphthalen-1-imine |
| PubChem CID | 58410610 |
| Molecular Formula | C18H19N |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | N-benzyl-6-methyl-3,4-dihydro-2H-naphthalen-1-imine |
| SMILES | Cc1ccc2c(c1)CCC/C2=N\Cc1ccccc1 |
| InChI | InChI=1S/C18H19N/c1-14-10-11-17-16(12-14)8-5-9-18(17)19-13-15-6-3-2-4-7-15/h2-4,6-7,10-12H,5,8-9,13H2,1H3/b19-18+ |
| InChIKey | GUIQFBGVAGVZOS-VHEBQXMUSA-N |
| XLogP | 4.32 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-benzyl-6-methyl-3,4-dihydro-2H-naphthalen-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-6-methyl-3,4-dihydro-2H-naphthalen-1-imine?
The IUPAC name of N-benzyl-6-methyl-3,4-dihydro-2H-naphthalen-1-imine (CID 58410610) is N-benzyl-6-methyl-3,4-dihydro-2H-naphthalen-1-imine.
What is the SMILES notation for N-benzyl-6-methyl-3,4-dihydro-2H-naphthalen-1-imine?
The canonical SMILES for N-benzyl-6-methyl-3,4-dihydro-2H-naphthalen-1-imine is Cc1ccc2c(c1)CCC/C2=N\Cc1ccccc1.
What is the InChIKey of N-benzyl-6-methyl-3,4-dihydro-2H-naphthalen-1-imine?
The InChIKey is GUIQFBGVAGVZOS-VHEBQXMUSA-N. The full InChI is InChI=1S/C18H19N/c1-14-10-11-17-16(12-14)8-5-9-18(17)19-13-15-6-3-2-4-7-15/h2-4,6-7,10-12H,5,8-9,13H2,1H3/b19-18+.
What are the key properties of N-benzyl-6-methyl-3,4-dihydro-2H-naphthalen-1-imine?
N-benzyl-6-methyl-3,4-dihydro-2H-naphthalen-1-imine has a molecular weight of 249.36 g/mol, XLogP of 4.32, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-6-methyl-3,4-dihydro-2H-naphthalen-1-imine is sourced from PubChem (CID 58410610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).