C38H44O4S4 — CID 58411040
7,19-bis(octylsulfonyl)-6,18-dithiahexacyclo[11.11.0.02,10.05,9.014,22.017,21]tetracosa-1(13),2(10),3,5(9),7,11,14(22),15,17(21),19,23-undecaene (PubChem CID 58411040) has the molecular formula C38H44O4S4 and a molecular weight of 693.03 g/mol. Its IUPAC name is 7,19-bis(octylsulfonyl)-6,18-dithiahexacyclo[11.11.0.02,10.05,9.014,22.017,21]tetracosa-1(13),2(10),3,5(9),7,11,14(22),15,17(21),19,23-undecaene.
| Compound Name | 7,19-bis(octylsulfonyl)-6,18-dithiahexacyclo[11.11.0.02,10.05,9.014,22.017,21]tetracosa-1(13),2(10),3,5(9),7,11,14(22),15,17(21),19,23-undecaene |
|---|---|
| PubChem CID | 58411040 |
| Molecular Formula | C38H44O4S4 |
| Molecular Weight | 693.03 g/mol |
| Exact Mass | 692.21 |
| IUPAC Name | 7,19-bis(octylsulfonyl)-6,18-dithiahexacyclo[11.11.0.02,10.05,9.014,22.017,21]tetracosa-1(13),2(10),3,5(9),7,11,14(22),15,17(21),19,23-undecaene |
| SMILES | CCCCCCCCS(=O)(=O)c1cc2c(ccc3c2ccc2c4ccc5sc(S(=O)(=O)CCCCCCCC)cc5c4ccc32)s1 |
| InChI | InChI=1S/C38H44O4S4/c1-3-5-7-9-11-13-23-45(39,40)37-25-33-31-17-15-28-27(29(31)19-21-35(33)43-37)16-18-32-30(28)20-22-36-34(32)26-38(44-36)46(41,42)24-14-12-10-8-6-4-2/h15-22,25-26H,3-14,23-24H2,1-2H3 |
| InChIKey | LLLYYKVZTVFVRF-UHFFFAOYSA-N |
| XLogP | 11.84 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.03 |
| LogP ≤ 5 | 11.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|