About 4-methyl-2,1,3-benzoxadiazole
4-methyl-2,1,3-benzoxadiazole (PubChem CID 584114) has the molecular formula C7H6N2O
and a molecular weight of 134.14 g/mol. Its IUPAC name is 4-methyl-2,1,3-benzoxadiazole.
Molecular Properties
| Compound Name | 4-methyl-2,1,3-benzoxadiazole |
| PubChem CID | 584114 |
| Molecular Formula | C7H6N2O |
| Molecular Weight | 134.14 g/mol |
| Exact Mass | 134.05 |
| IUPAC Name | 4-methyl-2,1,3-benzoxadiazole |
| SMILES | Cc1cccc2nonc12 |
| InChI | InChI=1S/C7H6N2O/c1-5-3-2-4-6-7(5)9-10-8-6/h2-4H,1H3 |
| InChIKey | PTXJEYIAUIOTSH-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.14 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-methyl-2,1,3-benzoxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-2,1,3-benzoxadiazole?
The IUPAC name of 4-methyl-2,1,3-benzoxadiazole (CID 584114) is 4-methyl-2,1,3-benzoxadiazole.
What is the SMILES notation for 4-methyl-2,1,3-benzoxadiazole?
The canonical SMILES for 4-methyl-2,1,3-benzoxadiazole is Cc1cccc2nonc12.
What is the InChIKey of 4-methyl-2,1,3-benzoxadiazole?
The InChIKey is PTXJEYIAUIOTSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2O/c1-5-3-2-4-6-7(5)9-10-8-6/h2-4H,1H3.
What are the key properties of 4-methyl-2,1,3-benzoxadiazole?
4-methyl-2,1,3-benzoxadiazole has a molecular weight of 134.14 g/mol, XLogP of 1.53, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-2,1,3-benzoxadiazole is sourced from PubChem (CID 584114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).