C32H28S2Si2 — CID 58411502
trimethyl-[2-[18-(2-trimethylsilylethynyl)-5,17-dithiahexacyclo[11.11.0.02,10.04,8.014,22.016,20]tetracosa-1(13),2,4(8),6,9,11,14,16(20),18,21,23-undecaen-6-yl]ethynyl]silane (PubChem CID 58411502) has the molecular formula C32H28S2Si2 and a molecular weight of 532.88 g/mol. Its IUPAC name is trimethyl-[2-[18-(2-trimethylsilylethynyl)-5,17-dithiahexacyclo[11.11.0.02,10.04,8.014,22.016,20]tetracosa-1(13),2,4(8),6,9,11,14,16(20),18,21,23-undecaen-6-yl]ethynyl]silane.
| Compound Name | trimethyl-[2-[18-(2-trimethylsilylethynyl)-5,17-dithiahexacyclo[11.11.0.02,10.04,8.014,22.016,20]tetracosa-1(13),2,4(8),6,9,11,14,16(20),18,21,23-undecaen-6-yl]ethynyl]silane |
|---|---|
| PubChem CID | 58411502 |
| Molecular Formula | C32H28S2Si2 |
| Molecular Weight | 532.88 g/mol |
| Exact Mass | 532.12 |
| IUPAC Name | trimethyl-[2-[18-(2-trimethylsilylethynyl)-5,17-dithiahexacyclo[11.11.0.02,10.04,8.014,22.016,20]tetracosa-1(13),2,4(8),6,9,11,14,16(20),18,21,23-undecaen-6-yl]ethynyl]silane |
| SMILES | C[Si](C)(C)C#Cc1cc2cc3ccc4c5cc6sc(C#C[Si](C)(C)C)cc6cc5ccc4c3cc2s1 |
| InChI | InChI=1S/C32H28S2Si2/c1-35(2,3)13-11-25-17-23-15-21-7-9-28-27(29(21)19-31(23)33-25)10-8-22-16-24-18-26(12-14-36(4,5)6)34-32(24)20-30(22)28/h7-10,15-20H,1-6H3 |
| InChIKey | SJHRJZHYGGUAOP-UHFFFAOYSA-N |
| XLogP | 10.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.88 |
| LogP ≤ 5 | 10.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|