C32H32Si2 — CID 58411688
trimethyl-(20-trimethylsilyl-7-hexacyclo[12.12.0.02,11.05,10.015,24.018,23]hexacosa-1(14),2(11),3,5(10),6,8,12,15(24),16,18(23),19,21,25-tridecaenyl)silane (PubChem CID 58411688) has the molecular formula C32H32Si2 and a molecular weight of 472.78 g/mol. Its IUPAC name is trimethyl-(20-trimethylsilyl-7-hexacyclo[12.12.0.02,11.05,10.015,24.018,23]hexacosa-1(14),2(11),3,5(10),6,8,12,15(24),16,18(23),19,21,25-tridecaenyl)silane.
| Compound Name | trimethyl-(20-trimethylsilyl-7-hexacyclo[12.12.0.02,11.05,10.015,24.018,23]hexacosa-1(14),2(11),3,5(10),6,8,12,15(24),16,18(23),19,21,25-tridecaenyl)silane |
|---|---|
| PubChem CID | 58411688 |
| Molecular Formula | C32H32Si2 |
| Molecular Weight | 472.78 g/mol |
| Exact Mass | 472.20 |
| IUPAC Name | trimethyl-(20-trimethylsilyl-7-hexacyclo[12.12.0.02,11.05,10.015,24.018,23]hexacosa-1(14),2(11),3,5(10),6,8,12,15(24),16,18(23),19,21,25-tridecaenyl)silane |
| SMILES | C[Si](C)(C)c1ccc2c(ccc3c2ccc2c4ccc5cc([Si](C)(C)C)ccc5c4ccc32)c1 |
| InChI | InChI=1S/C32H32Si2/c1-33(2,3)23-9-13-25-21(19-23)7-11-29-27(25)15-17-32-30-12-8-22-20-24(34(4,5)6)10-14-26(22)28(30)16-18-31(29)32/h7-20H,1-6H3 |
| InChIKey | LXEMVSVUDKEJNF-UHFFFAOYSA-N |
| XLogP | 8.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.78 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|