C47H50BN3O2 — CID 58412086
2,4-bis[4-(4-tert-butylphenyl)phenyl]-6-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3,5-triazine (PubChem CID 58412086) has the molecular formula C47H50BN3O2 and a molecular weight of 699.75 g/mol. Its IUPAC name is 2,4-bis[4-(4-tert-butylphenyl)phenyl]-6-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3,5-triazine.
| Compound Name | 2,4-bis[4-(4-tert-butylphenyl)phenyl]-6-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 58412086 |
| Molecular Formula | C47H50BN3O2 |
| Molecular Weight | 699.75 g/mol |
| Exact Mass | 699.40 |
| IUPAC Name | 2,4-bis[4-(4-tert-butylphenyl)phenyl]-6-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3,5-triazine |
| SMILES | CC(C)(C)c1ccc(-c2ccc(-c3nc(-c4ccc(B5OC(C)(C)C(C)(C)O5)cc4)nc(-c4ccc(-c5ccc(C(C)(C)C)cc5)cc4)n3)cc2)cc1 |
| InChI | InChI=1S/C47H50BN3O2/c1-44(2,3)38-25-19-33(20-26-38)31-11-15-35(16-12-31)41-49-42(36-17-13-32(14-18-36)34-21-27-39(28-22-34)45(4,5)6)51-43(50-41)37-23-29-40(30-24-37)48-52-46(7,8)47(9,10)53-48/h11-30H,1-10H3 |
| InChIKey | LMQSINQBDFEHEX-UHFFFAOYSA-N |
| XLogP | 11.10 |
| TPSA | 57.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.75 |
| LogP ≤ 5 | 11.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|