C72H65Br2N3 — CID 58412102
2,4-bis[4-(4-tert-butylphenyl)phenyl]-6-[4-[4-[2,7-dibromo-9-(4-hexylphenyl)fluoren-9-yl]phenyl]phenyl]-1,3,5-triazine (PubChem CID 58412102) has the molecular formula C72H65Br2N3 and a molecular weight of 1132.14 g/mol. Its IUPAC name is 2,4-bis[4-(4-tert-butylphenyl)phenyl]-6-[4-[4-[2,7-dibromo-9-(4-hexylphenyl)fluoren-9-yl]phenyl]phenyl]-1,3,5-triazine.
| Compound Name | 2,4-bis[4-(4-tert-butylphenyl)phenyl]-6-[4-[4-[2,7-dibromo-9-(4-hexylphenyl)fluoren-9-yl]phenyl]phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 58412102 |
| Molecular Formula | C72H65Br2N3 |
| Molecular Weight | 1132.14 g/mol |
| Exact Mass | 1129.35 |
| IUPAC Name | 2,4-bis[4-(4-tert-butylphenyl)phenyl]-6-[4-[4-[2,7-dibromo-9-(4-hexylphenyl)fluoren-9-yl]phenyl]phenyl]-1,3,5-triazine |
| SMILES | CCCCCCc1ccc(C2(c3ccc(-c4ccc(-c5nc(-c6ccc(-c7ccc(C(C)(C)C)cc7)cc6)nc(-c6ccc(-c7ccc(C(C)(C)C)cc7)cc6)n5)cc4)cc3)c3cc(Br)ccc3-c3ccc(Br)cc32)cc1 |
| InChI | InChI=1S/C72H65Br2N3/c1-8-9-10-11-12-47-13-33-59(34-14-47)72(65-45-61(73)41-43-63(65)64-44-42-62(74)46-66(64)72)60-39-31-53(32-40-60)50-19-25-56(26-20-50)69-76-67(54-21-15-48(16-22-54)51-27-35-57(36-28-51)70(2,3)4)75-68(77-69)55-23-17-49(18-24-55)52-29-37-58(38-30-52)71(5,6)7/h13-46H,8-12H2,1-7H3 |
| InChIKey | ZPBUCTQDLAHJGY-UHFFFAOYSA-N |
| XLogP | 20.48 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 77 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1132.14 |
| LogP ≤ 5 | 20.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|