C25H44N4O5 — CID 58412565
(2R,5R)-2-tert-butyl-N,7-dimethyl-5-[[(2R)-2-methyl-4-(3,4,4-trimethyl-2,5-dioxoimidazolidin-1-yl)butanoyl]amino]-4-oxooctanamide (PubChem CID 58412565) has the molecular formula C25H44N4O5 and a molecular weight of 480.65 g/mol. Its IUPAC name is (2R,5R)-2-tert-butyl-N,7-dimethyl-5-[[(2R)-2-methyl-4-(3,4,4-trimethyl-2,5-dioxoimidazolidin-1-yl)butanoyl]amino]-4-oxooctanamide.
| Compound Name | (2R,5R)-2-tert-butyl-N,7-dimethyl-5-[[(2R)-2-methyl-4-(3,4,4-trimethyl-2,5-dioxoimidazolidin-1-yl)butanoyl]amino]-4-oxooctanamide |
|---|---|
| PubChem CID | 58412565 |
| Molecular Formula | C25H44N4O5 |
| Molecular Weight | 480.65 g/mol |
| Exact Mass | 480.33 |
| IUPAC Name | (2R,5R)-2-tert-butyl-N,7-dimethyl-5-[[(2R)-2-methyl-4-(3,4,4-trimethyl-2,5-dioxoimidazolidin-1-yl)butanoyl]amino]-4-oxooctanamide |
| SMILES | CNC(=O)[C@H](CC(=O)[C@@H](CC(C)C)NC(=O)[C@H](C)CCN1C(=O)N(C)C(C)(C)C1=O)C(C)(C)C |
| InChI | InChI=1S/C25H44N4O5/c1-15(2)13-18(19(30)14-17(21(32)26-9)24(4,5)6)27-20(31)16(3)11-12-29-22(33)25(7,8)28(10)23(29)34/h15-18H,11-14H2,1-10H3,(H,26,32)(H,27,31)/t16-,17+,18-/m1/s1 |
| InChIKey | VBYSLGVRJLUVBQ-FGTMMUONSA-N |
| XLogP | 2.58 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.65 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|