C19H17N3O4 — CID 58412761
(2S,3R)-N,3-dihydroxy-2-[3-oxo-6-(2-phenylethynyl)-1H-indazol-2-yl]butanamide (PubChem CID 58412761) has the molecular formula C19H17N3O4 and a molecular weight of 351.36 g/mol. Its IUPAC name is (2S,3R)-N,3-dihydroxy-2-[3-oxo-6-(2-phenylethynyl)-1H-indazol-2-yl]butanamide.
| Compound Name | (2S,3R)-N,3-dihydroxy-2-[3-oxo-6-(2-phenylethynyl)-1H-indazol-2-yl]butanamide |
|---|---|
| PubChem CID | 58412761 |
| Molecular Formula | C19H17N3O4 |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | (2S,3R)-N,3-dihydroxy-2-[3-oxo-6-(2-phenylethynyl)-1H-indazol-2-yl]butanamide |
| SMILES | C[C@@H](O)[C@@H](C(=O)NO)n1[nH]c2cc(C#Cc3ccccc3)ccc2c1=O |
| InChI | InChI=1S/C19H17N3O4/c1-12(23)17(18(24)21-26)22-19(25)15-10-9-14(11-16(15)20-22)8-7-13-5-3-2-4-6-13/h2-6,9-12,17,20,23,26H,1H3,(H,21,24)/t12-,17+/m1/s1 |
| InChIKey | YVUWWXGEAKZKOR-PXAZEXFGSA-N |
| XLogP | 1.16 |
| TPSA | 107.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_65_B(7)', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|