About pentan-3-yl 3-methylimidazol-3-ium-1-carboxylate
pentan-3-yl 3-methylimidazol-3-ium-1-carboxylate (PubChem CID 58413704) has the molecular formula C10H17N2O2+
and a molecular weight of 197.26 g/mol. Its IUPAC name is pentan-3-yl 3-methylimidazol-3-ium-1-carboxylate.
Molecular Properties
| Compound Name | pentan-3-yl 3-methylimidazol-3-ium-1-carboxylate |
| PubChem CID | 58413704 |
| Molecular Formula | C10H17N2O2+ |
| Molecular Weight | 197.26 g/mol |
| Exact Mass | 197.13 |
| IUPAC Name | pentan-3-yl 3-methylimidazol-3-ium-1-carboxylate |
| SMILES | CCC(CC)OC(=O)n1cc[n+](C)c1 |
| InChI | InChI=1S/C10H17N2O2/c1-4-9(5-2)14-10(13)12-7-6-11(3)8-12/h6-9H,4-5H2,1-3H3/q+1 |
| InChIKey | WEVMVJCHODRMDG-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 35.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.26 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze pentan-3-yl 3-methylimidazol-3-ium-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentan-3-yl 3-methylimidazol-3-ium-1-carboxylate?
The IUPAC name of pentan-3-yl 3-methylimidazol-3-ium-1-carboxylate (CID 58413704) is pentan-3-yl 3-methylimidazol-3-ium-1-carboxylate.
What is the SMILES notation for pentan-3-yl 3-methylimidazol-3-ium-1-carboxylate?
The canonical SMILES for pentan-3-yl 3-methylimidazol-3-ium-1-carboxylate is CCC(CC)OC(=O)n1cc[n+](C)c1.
What is the InChIKey of pentan-3-yl 3-methylimidazol-3-ium-1-carboxylate?
The InChIKey is WEVMVJCHODRMDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N2O2/c1-4-9(5-2)14-10(13)12-7-6-11(3)8-12/h6-9H,4-5H2,1-3H3/q+1.
What are the key properties of pentan-3-yl 3-methylimidazol-3-ium-1-carboxylate?
pentan-3-yl 3-methylimidazol-3-ium-1-carboxylate has a molecular weight of 197.26 g/mol, XLogP of 1.49, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pentan-3-yl 3-methylimidazol-3-ium-1-carboxylate is sourced from PubChem (CID 58413704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).