About cyclopenta[c]thiopyran
cyclopenta[c]thiopyran (PubChem CID 584139) has the molecular formula C8H6S
and a molecular weight of 134.20 g/mol. Its IUPAC name is cyclopenta[c]thiopyran.
Molecular Properties
| Compound Name | cyclopenta[c]thiopyran |
| PubChem CID | 584139 |
| Molecular Formula | C8H6S |
| Molecular Weight | 134.20 g/mol |
| Exact Mass | 134.02 |
| IUPAC Name | cyclopenta[c]thiopyran |
| SMILES | c1cc2ccscc-2c1 |
| InChI | InChI=1S/C8H6S/c1-2-7-4-5-9-6-8(7)3-1/h1-6H |
| InChIKey | WITCGPMUKHXQGW-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.20 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze cyclopenta[c]thiopyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopenta[c]thiopyran?
The IUPAC name of cyclopenta[c]thiopyran (CID 584139) is cyclopenta[c]thiopyran.
What is the SMILES notation for cyclopenta[c]thiopyran?
The canonical SMILES for cyclopenta[c]thiopyran is c1cc2ccscc-2c1.
What is the InChIKey of cyclopenta[c]thiopyran?
The InChIKey is WITCGPMUKHXQGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6S/c1-2-7-4-5-9-6-8(7)3-1/h1-6H.
What are the key properties of cyclopenta[c]thiopyran?
cyclopenta[c]thiopyran has a molecular weight of 134.20 g/mol, XLogP of 2.85, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopenta[c]thiopyran is sourced from PubChem (CID 584139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).