C15H18FN3O4S — CID 58414503
N-(2-fluoro-4-methylsulfonylphenyl)-5-methoxy-6-propan-2-yloxypyrimidin-4-amine (PubChem CID 58414503) has the molecular formula C15H18FN3O4S and a molecular weight of 355.39 g/mol. Its IUPAC name is N-(2-fluoro-4-methylsulfonylphenyl)-5-methoxy-6-propan-2-yloxypyrimidin-4-amine.
| Compound Name | N-(2-fluoro-4-methylsulfonylphenyl)-5-methoxy-6-propan-2-yloxypyrimidin-4-amine |
|---|---|
| PubChem CID | 58414503 |
| Molecular Formula | C15H18FN3O4S |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | N-(2-fluoro-4-methylsulfonylphenyl)-5-methoxy-6-propan-2-yloxypyrimidin-4-amine |
| SMILES | COc1c(Nc2ccc(S(C)(=O)=O)cc2F)ncnc1OC(C)C |
| InChI | InChI=1S/C15H18FN3O4S/c1-9(2)23-15-13(22-3)14(17-8-18-15)19-12-6-5-10(7-11(12)16)24(4,20)21/h5-9H,1-4H3,(H,17,18,19) |
| InChIKey | CYQRXNLQZGGSCR-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |