About 4-(cyclobutylmethyl)-1,2-difluorobenzene
4-(cyclobutylmethyl)-1,2-difluorobenzene (PubChem CID 58414524) has the molecular formula C11H12F2
and a molecular weight of 182.21 g/mol. Its IUPAC name is 4-(cyclobutylmethyl)-1,2-difluorobenzene.
Molecular Properties
| Compound Name | 4-(cyclobutylmethyl)-1,2-difluorobenzene |
| PubChem CID | 58414524 |
| Molecular Formula | C11H12F2 |
| Molecular Weight | 182.21 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | 4-(cyclobutylmethyl)-1,2-difluorobenzene |
| SMILES | Fc1ccc(CC2CCC2)cc1F |
| InChI | InChI=1S/C11H12F2/c12-10-5-4-9(7-11(10)13)6-8-2-1-3-8/h4-5,7-8H,1-3,6H2 |
| InChIKey | ROUHBQWVJFPYBZ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.21 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 4-(cyclobutylmethyl)-1,2-difluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(cyclobutylmethyl)-1,2-difluorobenzene?
The IUPAC name of 4-(cyclobutylmethyl)-1,2-difluorobenzene (CID 58414524) is 4-(cyclobutylmethyl)-1,2-difluorobenzene.
What is the SMILES notation for 4-(cyclobutylmethyl)-1,2-difluorobenzene?
The canonical SMILES for 4-(cyclobutylmethyl)-1,2-difluorobenzene is Fc1ccc(CC2CCC2)cc1F.
What is the InChIKey of 4-(cyclobutylmethyl)-1,2-difluorobenzene?
The InChIKey is ROUHBQWVJFPYBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12F2/c12-10-5-4-9(7-11(10)13)6-8-2-1-3-8/h4-5,7-8H,1-3,6H2.
What are the key properties of 4-(cyclobutylmethyl)-1,2-difluorobenzene?
4-(cyclobutylmethyl)-1,2-difluorobenzene has a molecular weight of 182.21 g/mol, XLogP of 3.31, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(cyclobutylmethyl)-1,2-difluorobenzene is sourced from PubChem (CID 58414524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).