C26H24FNO3 — CID 58415408
3-[[4-(5-benzyl-1-benzofuran-2-yl)-3-fluorophenyl]methylamino]-2-methylpropanoic acid (PubChem CID 58415408) has the molecular formula C26H24FNO3 and a molecular weight of 417.48 g/mol. Its IUPAC name is 3-[[4-(5-benzyl-1-benzofuran-2-yl)-3-fluorophenyl]methylamino]-2-methylpropanoic acid.
| Compound Name | 3-[[4-(5-benzyl-1-benzofuran-2-yl)-3-fluorophenyl]methylamino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 58415408 |
| Molecular Formula | C26H24FNO3 |
| Molecular Weight | 417.48 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | 3-[[4-(5-benzyl-1-benzofuran-2-yl)-3-fluorophenyl]methylamino]-2-methylpropanoic acid |
| SMILES | CC(CNCc1ccc(-c2cc3cc(Cc4ccccc4)ccc3o2)c(F)c1)C(=O)O |
| InChI | InChI=1S/C26H24FNO3/c1-17(26(29)30)15-28-16-20-7-9-22(23(27)13-20)25-14-21-12-19(8-10-24(21)31-25)11-18-5-3-2-4-6-18/h2-10,12-14,17,28H,11,15-16H2,1H3,(H,29,30) |
| InChIKey | LKAJGVZFQVIWCD-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.48 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |