C12H12F5NO2 — CID 584158
2,2,3,3,3-pentafluoro-N-[2-(2-methoxyphenyl)ethyl]propanamide (PubChem CID 584158) has the molecular formula C12H12F5NO2 and a molecular weight of 297.22 g/mol. Its IUPAC name is 2,2,3,3,3-pentafluoro-N-[2-(2-methoxyphenyl)ethyl]propanamide.
| Compound Name | 2,2,3,3,3-pentafluoro-N-[2-(2-methoxyphenyl)ethyl]propanamide |
|---|---|
| PubChem CID | 584158 |
| Molecular Formula | C12H12F5NO2 |
| Molecular Weight | 297.22 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | 2,2,3,3,3-pentafluoro-N-[2-(2-methoxyphenyl)ethyl]propanamide |
| SMILES | COc1ccccc1CCNC(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H12F5NO2/c1-20-9-5-3-2-4-8(9)6-7-18-10(19)11(13,14)12(15,16)17/h2-5H,6-7H2,1H3,(H,18,19) |
| InChIKey | NSAAOFOOARKVEO-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.22 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|