C22H20N2O2 — CID 58415876
5-cyclopropyl-2-[[2-(2-methylphenyl)pyrimidin-5-yl]methyl]benzoic acid (PubChem CID 58415876) has the molecular formula C22H20N2O2 and a molecular weight of 344.41 g/mol. Its IUPAC name is 5-cyclopropyl-2-[[2-(2-methylphenyl)pyrimidin-5-yl]methyl]benzoic acid.
| Compound Name | 5-cyclopropyl-2-[[2-(2-methylphenyl)pyrimidin-5-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 58415876 |
| Molecular Formula | C22H20N2O2 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | 5-cyclopropyl-2-[[2-(2-methylphenyl)pyrimidin-5-yl]methyl]benzoic acid |
| SMILES | Cc1ccccc1-c1ncc(Cc2ccc(C3CC3)cc2C(=O)O)cn1 |
| InChI | InChI=1S/C22H20N2O2/c1-14-4-2-3-5-19(14)21-23-12-15(13-24-21)10-18-9-8-17(16-6-7-16)11-20(18)22(25)26/h2-5,8-9,11-13,16H,6-7,10H2,1H3,(H,25,26) |
| InChIKey | UUHVECBJCUGQKE-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |