C26H31N3O2S — CID 58415982
tert-butyl N-[4-[5-(2-imino-2-thiophen-2-ylethyl)-1H-indol-3-yl]cyclohex-3-en-1-yl]-N-methylcarbamate (PubChem CID 58415982) has the molecular formula C26H31N3O2S and a molecular weight of 449.62 g/mol. Its IUPAC name is tert-butyl N-[4-[5-(2-imino-2-thiophen-2-ylethyl)-1H-indol-3-yl]cyclohex-3-en-1-yl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[4-[5-(2-imino-2-thiophen-2-ylethyl)-1H-indol-3-yl]cyclohex-3-en-1-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 58415982 |
| Molecular Formula | C26H31N3O2S |
| Molecular Weight | 449.62 g/mol |
| Exact Mass | 449.21 |
| IUPAC Name | tert-butyl N-[4-[5-(2-imino-2-thiophen-2-ylethyl)-1H-indol-3-yl]cyclohex-3-en-1-yl]-N-methylcarbamate |
| SMILES | [H]/N=C(/Cc1ccc2[nH]cc(C3=CCC(N(C)C(=O)OC(C)(C)C)CC3)c2c1)c1cccs1 |
| InChI | InChI=1S/C26H31N3O2S/c1-26(2,3)31-25(30)29(4)19-10-8-18(9-11-19)21-16-28-23-12-7-17(14-20(21)23)15-22(27)24-6-5-13-32-24/h5-8,12-14,16,19,27-28H,9-11,15H2,1-4H3/b27-22- |
| InChIKey | BAAFFCLTIJNHJL-QYQHSDTDSA-N |
| XLogP | 6.64 |
| TPSA | 69.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.62 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|