About 1,3-thiazol-5-ylmethyl N-propylcarbamate
1,3-thiazol-5-ylmethyl N-propylcarbamate (PubChem CID 58416919) has the molecular formula C8H12N2O2S
and a molecular weight of 200.26 g/mol. Its IUPAC name is 1,3-thiazol-5-ylmethyl N-propylcarbamate.
Molecular Properties
| Compound Name | 1,3-thiazol-5-ylmethyl N-propylcarbamate |
| PubChem CID | 58416919 |
| Molecular Formula | C8H12N2O2S |
| Molecular Weight | 200.26 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | 1,3-thiazol-5-ylmethyl N-propylcarbamate |
| SMILES | CCCNC(=O)OCc1cncs1 |
| InChI | InChI=1S/C8H12N2O2S/c1-2-3-10-8(11)12-5-7-4-9-6-13-7/h4,6H,2-3,5H2,1H3,(H,10,11) |
| InChIKey | YMMAUNQEKMGBCC-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.26 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1,3-thiazol-5-ylmethyl N-propylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-thiazol-5-ylmethyl N-propylcarbamate?
The IUPAC name of 1,3-thiazol-5-ylmethyl N-propylcarbamate (CID 58416919) is 1,3-thiazol-5-ylmethyl N-propylcarbamate.
What is the SMILES notation for 1,3-thiazol-5-ylmethyl N-propylcarbamate?
The canonical SMILES for 1,3-thiazol-5-ylmethyl N-propylcarbamate is CCCNC(=O)OCc1cncs1.
What is the InChIKey of 1,3-thiazol-5-ylmethyl N-propylcarbamate?
The InChIKey is YMMAUNQEKMGBCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O2S/c1-2-3-10-8(11)12-5-7-4-9-6-13-7/h4,6H,2-3,5H2,1H3,(H,10,11).
What are the key properties of 1,3-thiazol-5-ylmethyl N-propylcarbamate?
1,3-thiazol-5-ylmethyl N-propylcarbamate has a molecular weight of 200.26 g/mol, XLogP of 1.78, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-thiazol-5-ylmethyl N-propylcarbamate is sourced from PubChem (CID 58416919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).