About 1,2-dimethyl-4H-pyrimidine
1,2-dimethyl-4H-pyrimidine (PubChem CID 58417989) has the molecular formula C6H10N2
and a molecular weight of 110.16 g/mol. Its IUPAC name is 1,2-dimethyl-4H-pyrimidine.
Molecular Properties
| Compound Name | 1,2-dimethyl-4H-pyrimidine |
| PubChem CID | 58417989 |
| Molecular Formula | C6H10N2 |
| Molecular Weight | 110.16 g/mol |
| Exact Mass | 110.08 |
| IUPAC Name | 1,2-dimethyl-4H-pyrimidine |
| SMILES | CC1=NCC=CN1C |
| InChI | InChI=1S/C6H10N2/c1-6-7-4-3-5-8(6)2/h3,5H,4H2,1-2H3 |
| InChIKey | JAHVOMSIJYMOEY-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 110.16 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,2-dimethyl-4H-pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dimethyl-4H-pyrimidine?
The IUPAC name of 1,2-dimethyl-4H-pyrimidine (CID 58417989) is 1,2-dimethyl-4H-pyrimidine.
What is the SMILES notation for 1,2-dimethyl-4H-pyrimidine?
The canonical SMILES for 1,2-dimethyl-4H-pyrimidine is CC1=NCC=CN1C.
What is the InChIKey of 1,2-dimethyl-4H-pyrimidine?
The InChIKey is JAHVOMSIJYMOEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2/c1-6-7-4-3-5-8(6)2/h3,5H,4H2,1-2H3.
What are the key properties of 1,2-dimethyl-4H-pyrimidine?
1,2-dimethyl-4H-pyrimidine has a molecular weight of 110.16 g/mol, XLogP of 0.86, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dimethyl-4H-pyrimidine is sourced from PubChem (CID 58417989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).